Write a structural formula for 2-Methyl-4-hexenoic acid (Z isomer)

2-Methyl-4-hexenoic acid (Z isomer)

Final answer: The structural formula for 2-Methyl-4-hexenoic acid (Z isomer) is: CH3-CH(CH3)-CH=CH-CH2-COOH.

Explanation: The structural formula for 2-Methyl-4-hexenoic acid (Z isomer) is:

Here, the methyl group (CH3) is attached to the second carbon (C2) of the main chain (hexenoic acid).

Therefore, the structural formula for 2-Methyl-4-hexenoic acid (Z isomer) is: CH3-CH(CH3)-CH=CH-CH2-COOH

What is the structural formula for 2-Methyl-4-hexenoic acid (Z isomer)? The structural formula for 2-Methyl-4-hexenoic acid (Z isomer) is: CH3-CH(CH3)-CH=CH-CH2-COOH.
← Minor compounds in portland cement and their impact Chemical calculation exciting challenge of dosage calculation →